C12H28N6O3 — CID 22928527
5-(diaminomethylideneamino)-2-nitramidopentanamide;2,3-dimethylbutane (PubChem CID 22928527) has the molecular formula C12H28N6O3 and a molecular weight of 304.40 g/mol. Its IUPAC name is 5-(diaminomethylideneamino)-2-nitramidopentanamide;2,3-dimethylbutane.
| Compound Name | 5-(diaminomethylideneamino)-2-nitramidopentanamide;2,3-dimethylbutane |
|---|---|
| PubChem CID | 22928527 |
| Molecular Formula | C12H28N6O3 |
| Molecular Weight | 304.40 g/mol |
| Exact Mass | 304.22 |
| IUPAC Name | 5-(diaminomethylideneamino)-2-nitramidopentanamide;2,3-dimethylbutane |
| SMILES | CC(C)C(C)C.NC(=O)C(CCCN=C(N)N)N[N+](=O)[O-] |
| InChI | InChI=1S/C6H14N6O3.C6H14/c7-5(13)4(11-12(14)15)2-1-3-10-6(8)9;1-5(2)6(3)4/h4,11H,1-3H2,(H2,7,13)(H4,8,9,10);5-6H,1-4H3 |
| InChIKey | HICKVAIGTOBBDS-UHFFFAOYSA-N |
| XLogP | -0.03 |
| TPSA | 162.66 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 304.40 |
| LogP ≤ 5 | -0.03 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'}, {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'N-nitroso', 'substructure': 'N/A'} |
|---|