C7H16ClN5O4 — CID 170844430
(2S)-5-[[amino(nitramido)methylidene]amino]-2-(methylamino)pentanoic acid;hydrochloride (PubChem CID 170844430) has the molecular formula C7H16ClN5O4 and a molecular weight of 269.69 g/mol. Its IUPAC name is (2S)-5-[[amino(nitramido)methylidene]amino]-2-(methylamino)pentanoic acid;hydrochloride.
| Compound Name | (2S)-5-[[amino(nitramido)methylidene]amino]-2-(methylamino)pentanoic acid;hydrochloride |
|---|---|
| PubChem CID | 170844430 |
| Molecular Formula | C7H16ClN5O4 |
| Molecular Weight | 269.69 g/mol |
| Exact Mass | 269.09 |
| IUPAC Name | (2S)-5-[[amino(nitramido)methylidene]amino]-2-(methylamino)pentanoic acid;hydrochloride |
| SMILES | CN[C@@H](CCC/N=C(\N)N[N+](=O)[O-])C(=O)O.Cl |
| InChI | InChI=1S/C7H15N5O4.ClH/c1-9-5(6(13)14)3-2-4-10-7(8)11-12(15)16;/h5,9H,2-4H2,1H3,(H,13,14)(H3,8,10,11);1H/t5-;/m0./s1 |
| InChIKey | BKTGSAZMZMPIHP-JEDNCBNOSA-N |
| XLogP | -1.04 |
| TPSA | 142.88 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 17 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 269.69 |
| LogP ≤ 5 | -1.04 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'}, {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'N-nitroso', 'substructure': 'N/A'} |
|---|