C14H21N5O6 — CID 90788325
(2S)-5-[[amino(nitramido)methylidene]amino]-2-[(4-hydroxy-3-methoxyphenyl)methylamino]pentanoic acid (PubChem CID 90788325) has the molecular formula C14H21N5O6 and a molecular weight of 355.35 g/mol. Its IUPAC name is (2S)-5-[[amino(nitramido)methylidene]amino]-2-[(4-hydroxy-3-methoxyphenyl)methylamino]pentanoic acid.
| Compound Name | (2S)-5-[[amino(nitramido)methylidene]amino]-2-[(4-hydroxy-3-methoxyphenyl)methylamino]pentanoic acid |
|---|---|
| PubChem CID | 90788325 |
| Molecular Formula | C14H21N5O6 |
| Molecular Weight | 355.35 g/mol |
| Exact Mass | 355.15 |
| IUPAC Name | (2S)-5-[[amino(nitramido)methylidene]amino]-2-[(4-hydroxy-3-methoxyphenyl)methylamino]pentanoic acid |
| SMILES | COc1cc(CN[C@@H](CCC/N=C(\N)N[N+](=O)[O-])C(=O)O)ccc1O |
| InChI | InChI=1S/C14H21N5O6/c1-25-12-7-9(4-5-11(12)20)8-17-10(13(21)22)3-2-6-16-14(15)18-19(23)24/h4-5,7,10,17,20H,2-3,6,8H2,1H3,(H,21,22)(H3,15,16,18)/t10-/m0/s1 |
| InChIKey | WESCQQLWWVRQGU-JTQLQIEISA-N |
| XLogP | -0.18 |
| TPSA | 172.34 Ų |
| H-Bond Donors | 5 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 355.35 |
| LogP ≤ 5 | -0.18 |
| H-Bond Donors ≤ 5 | 5 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'}, {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'N-nitroso', 'substructure': 'N/A'} |
|---|