C21H35N5O5 — CID 22637115
5-[[amino(nitramido)methylidene]amino]-2-[(3,5-ditert-butyl-4-hydroxyphenyl)methylamino]pentanoic acid (PubChem CID 22637115) has the molecular formula C21H35N5O5 and a molecular weight of 437.54 g/mol. Its IUPAC name is 5-[[amino(nitramido)methylidene]amino]-2-[(3,5-ditert-butyl-4-hydroxyphenyl)methylamino]pentanoic acid.
| Compound Name | 5-[[amino(nitramido)methylidene]amino]-2-[(3,5-ditert-butyl-4-hydroxyphenyl)methylamino]pentanoic acid |
|---|---|
| PubChem CID | 22637115 |
| Molecular Formula | C21H35N5O5 |
| Molecular Weight | 437.54 g/mol |
| Exact Mass | 437.26 |
| IUPAC Name | 5-[[amino(nitramido)methylidene]amino]-2-[(3,5-ditert-butyl-4-hydroxyphenyl)methylamino]pentanoic acid |
| SMILES | CC(C)(C)c1cc(CNC(CCC/N=C(\N)N[N+](=O)[O-])C(=O)O)cc(C(C)(C)C)c1O |
| InChI | InChI=1S/C21H35N5O5/c1-20(2,3)14-10-13(11-15(17(14)27)21(4,5)6)12-24-16(18(28)29)8-7-9-23-19(22)25-26(30)31/h10-11,16,24,27H,7-9,12H2,1-6H3,(H,28,29)(H3,22,23,25) |
| InChIKey | OYHDNZDYLNQFIA-UHFFFAOYSA-N |
| XLogP | 2.41 |
| TPSA | 163.11 Ų |
| H-Bond Donors | 5 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 31 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 437.54 |
| LogP ≤ 5 | 2.41 |
| H-Bond Donors ≤ 5 | 5 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'}, {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'N-nitroso', 'substructure': 'N/A'} |
|---|