C6H14N6O3 — CID 14179321
2-amino-5-[[amino(nitramido)methylidene]amino]pentanamide (PubChem CID 14179321) has the molecular formula C6H14N6O3 and a molecular weight of 218.22 g/mol. Its IUPAC name is 2-amino-5-[[amino(nitramido)methylidene]amino]pentanamide.
| Compound Name | 2-amino-5-[[amino(nitramido)methylidene]amino]pentanamide |
|---|---|
| PubChem CID | 14179321 |
| Molecular Formula | C6H14N6O3 |
| Molecular Weight | 218.22 g/mol |
| Exact Mass | 218.11 |
| IUPAC Name | 2-amino-5-[[amino(nitramido)methylidene]amino]pentanamide |
| SMILES | NC(=O)C(N)CCC/N=C(\N)N[N+](=O)[O-] |
| InChI | InChI=1S/C6H14N6O3/c7-4(5(8)13)2-1-3-10-6(9)11-12(14)15/h4H,1-3,7H2,(H2,8,13)(H3,9,10,11) |
| InChIKey | BUSHIXDXHSGLAB-UHFFFAOYSA-N |
| XLogP | -2.32 |
| TPSA | 162.66 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 15 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 218.22 |
| LogP ≤ 5 | -2.32 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'}, {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'N-nitroso', 'substructure': 'N/A'} |
|---|