C7H15N5O3 — CID 173187265
(2S)-2-amino-5-[(1-amino-2-nitroethylidene)amino]pentanamide (PubChem CID 173187265) has the molecular formula C7H15N5O3 and a molecular weight of 217.23 g/mol. Its IUPAC name is (2S)-2-amino-5-[(1-amino-2-nitroethylidene)amino]pentanamide.
| Compound Name | (2S)-2-amino-5-[(1-amino-2-nitroethylidene)amino]pentanamide |
|---|---|
| PubChem CID | 173187265 |
| Molecular Formula | C7H15N5O3 |
| Molecular Weight | 217.23 g/mol |
| Exact Mass | 217.12 |
| IUPAC Name | (2S)-2-amino-5-[(1-amino-2-nitroethylidene)amino]pentanamide |
| SMILES | NC(=O)[C@@H](N)CCC/N=C(/N)C[N+](=O)[O-] |
| InChI | InChI=1S/C7H15N5O3/c8-5(7(10)13)2-1-3-11-6(9)4-12(14)15/h5H,1-4,8H2,(H2,9,11)(H2,10,13)/t5-/m0/s1 |
| InChIKey | LODJRISQOZTDAG-YFKPBYRVSA-N |
| XLogP | -1.79 |
| TPSA | 150.63 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 15 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 217.23 |
| LogP ≤ 5 | -1.79 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'}, {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|