C6H13AgN5O4 — CID 174523791
nitro (2S)-2-amino-5-(diaminomethylideneamino)pentanoate;silver (PubChem CID 174523791) has the molecular formula C6H13AgN5O4 and a molecular weight of 327.07 g/mol. Its IUPAC name is nitro (2S)-2-amino-5-(diaminomethylideneamino)pentanoate;silver.
| Compound Name | nitro (2S)-2-amino-5-(diaminomethylideneamino)pentanoate;silver |
|---|---|
| PubChem CID | 174523791 |
| Molecular Formula | C6H13AgN5O4 |
| Molecular Weight | 327.07 g/mol |
| Exact Mass | 326.00 |
| IUPAC Name | nitro (2S)-2-amino-5-(diaminomethylideneamino)pentanoate;silver |
| SMILES | NC(N)=NCCC[C@H](N)C(=O)O[N+](=O)[O-].[Ag] |
| InChI | InChI=1S/C6H13N5O4.Ag/c7-4(5(12)15-11(13)14)2-1-3-10-6(8)9;/h4H,1-3,7H2,(H4,8,9,10);/t4-;/m0./s1 |
| InChIKey | WJXJANGICIJWGF-WCCKRBBISA-N |
| XLogP | -1.90 |
| TPSA | 159.86 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 16 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 327.07 |
| LogP ≤ 5 | -1.90 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'}, {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|