C12H17N5O4 — CID 165358818
(4-nitrophenyl) (2S)-2-amino-5-(diaminomethylideneamino)pentanoate (PubChem CID 165358818) has the molecular formula C12H17N5O4 and a molecular weight of 295.30 g/mol. Its IUPAC name is (4-nitrophenyl) (2S)-2-amino-5-(diaminomethylideneamino)pentanoate.
| Compound Name | (4-nitrophenyl) (2S)-2-amino-5-(diaminomethylideneamino)pentanoate |
|---|---|
| PubChem CID | 165358818 |
| Molecular Formula | C12H17N5O4 |
| Molecular Weight | 295.30 g/mol |
| Exact Mass | 295.13 |
| IUPAC Name | (4-nitrophenyl) (2S)-2-amino-5-(diaminomethylideneamino)pentanoate |
| SMILES | NC(N)=NCCC[C@H](N)C(=O)Oc1ccc([N+](=O)[O-])cc1 |
| InChI | InChI=1S/C12H17N5O4/c13-10(2-1-7-16-12(14)15)11(18)21-9-5-3-8(4-6-9)17(19)20/h3-6,10H,1-2,7,13H2,(H4,14,15,16)/t10-/m0/s1 |
| InChIKey | BMWZGZCWUKYMIA-JTQLQIEISA-N |
| XLogP | -0.12 |
| TPSA | 159.86 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 295.30 |
| LogP ≤ 5 | -0.12 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'}, {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|