C6H17N7O11 — CID 86628840
(2S)-2-amino-5-(diaminomethylideneamino)pentanoic acid;tris(nitric acid) (PubChem CID 86628840) has the molecular formula C6H17N7O11 and a molecular weight of 363.24 g/mol. Its IUPAC name is (2S)-2-amino-5-(diaminomethylideneamino)pentanoic acid;tris(nitric acid).
| Compound Name | (2S)-2-amino-5-(diaminomethylideneamino)pentanoic acid;tris(nitric acid) |
|---|---|
| PubChem CID | 86628840 |
| Molecular Formula | C6H17N7O11 |
| Molecular Weight | 363.24 g/mol |
| Exact Mass | 363.10 |
| IUPAC Name | (2S)-2-amino-5-(diaminomethylideneamino)pentanoic acid;tris(nitric acid) |
| SMILES | NC(N)=NCCC[C@H](N)C(=O)O.O=[N+]([O-])O.O=[N+]([O-])O.O=[N+]([O-])O |
| InChI | InChI=1S/C6H14N4O2.3HNO3/c7-4(5(11)12)2-1-3-10-6(8)9;3*2-1(3)4/h4H,1-3,7H2,(H,11,12)(H4,8,9,10);3*(H,2,3,4)/t4-;;;/m0.../s1 |
| InChIKey | XELOMAOTVADGHO-WJXVXWFNSA-N |
| XLogP | -2.59 |
| TPSA | 317.83 Ų |
| H-Bond Donors | 7 |
| H-Bond Acceptors | 9 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 24 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 363.24 |
| LogP ≤ 5 | -2.59 |
| H-Bond Donors ≤ 5 | 7 |
| H-Bond Acceptors ≤ 10 | 9 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'}, {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|