C12H20Cl2N4O2 — CID 139830278
phenyl (2S)-2-amino-5-(diaminomethylideneamino)pentanoate;dihydrochloride (PubChem CID 139830278) has the molecular formula C12H20Cl2N4O2 and a molecular weight of 323.22 g/mol. Its IUPAC name is phenyl (2S)-2-amino-5-(diaminomethylideneamino)pentanoate;dihydrochloride.
| Compound Name | phenyl (2S)-2-amino-5-(diaminomethylideneamino)pentanoate;dihydrochloride |
|---|---|
| PubChem CID | 139830278 |
| Molecular Formula | C12H20Cl2N4O2 |
| Molecular Weight | 323.22 g/mol |
| Exact Mass | 322.10 |
| IUPAC Name | phenyl (2S)-2-amino-5-(diaminomethylideneamino)pentanoate;dihydrochloride |
| SMILES | Cl.Cl.NC(N)=NCCC[C@H](N)C(=O)Oc1ccccc1 |
| InChI | InChI=1S/C12H18N4O2.2ClH/c13-10(7-4-8-16-12(14)15)11(17)18-9-5-2-1-3-6-9;;/h1-3,5-6,10H,4,7-8,13H2,(H4,14,15,16);2*1H/t10-;;/m0../s1 |
| InChIKey | NQZNKGTZDJBXGE-XRIOVQLTSA-N |
| XLogP | 0.82 |
| TPSA | 116.72 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 323.22 |
| LogP ≤ 5 | 0.82 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'}, {'alert_name': 'phenol_ester', 'substructure': 'N/A'} |
|---|