C14H29N5O3 — CID 160510004
(2S)-2-amino-6-[(1-amino-2-nitroethylidene)amino]-N-hexylhexanamide (PubChem CID 160510004) has the molecular formula C14H29N5O3 and a molecular weight of 315.42 g/mol. Its IUPAC name is (2S)-2-amino-6-[(1-amino-2-nitroethylidene)amino]-N-hexylhexanamide.
| Compound Name | (2S)-2-amino-6-[(1-amino-2-nitroethylidene)amino]-N-hexylhexanamide |
|---|---|
| PubChem CID | 160510004 |
| Molecular Formula | C14H29N5O3 |
| Molecular Weight | 315.42 g/mol |
| Exact Mass | 315.23 |
| IUPAC Name | (2S)-2-amino-6-[(1-amino-2-nitroethylidene)amino]-N-hexylhexanamide |
| SMILES | CCCCCCNC(=O)[C@@H](N)CCCC/N=C(/N)C[N+](=O)[O-] |
| InChI | InChI=1S/C14H29N5O3/c1-2-3-4-6-10-18-14(20)12(15)8-5-7-9-17-13(16)11-19(21)22/h12H,2-11,15H2,1H3,(H2,16,17)(H,18,20)/t12-/m0/s1 |
| InChIKey | QSXPEUUJEGTYRY-LBPRGKRZSA-N |
| XLogP | 0.81 |
| TPSA | 136.64 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 13 |
| Heavy Atoms | 22 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 315.42 |
| LogP ≤ 5 | 0.81 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'}, {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|