C7H16N6O3 — CID 154445908
(2S)-2-amino-5-[[amino(nitramido)methylidene]amino]-N-methylpentanamide (PubChem CID 154445908) has the molecular formula C7H16N6O3 and a molecular weight of 232.24 g/mol. Its IUPAC name is (2S)-2-amino-5-[[amino(nitramido)methylidene]amino]-N-methylpentanamide.
| Compound Name | (2S)-2-amino-5-[[amino(nitramido)methylidene]amino]-N-methylpentanamide |
|---|---|
| PubChem CID | 154445908 |
| Molecular Formula | C7H16N6O3 |
| Molecular Weight | 232.24 g/mol |
| Exact Mass | 232.13 |
| IUPAC Name | (2S)-2-amino-5-[[amino(nitramido)methylidene]amino]-N-methylpentanamide |
| SMILES | CNC(=O)[C@@H](N)CCC/N=C(\N)N[N+](=O)[O-] |
| InChI | InChI=1S/C7H16N6O3/c1-10-6(14)5(8)3-2-4-11-7(9)12-13(15)16/h5H,2-4,8H2,1H3,(H,10,14)(H3,9,11,12)/t5-/m0/s1 |
| InChIKey | BZWOEQSQWFKMQE-YFKPBYRVSA-N |
| XLogP | -2.06 |
| TPSA | 148.67 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 16 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 232.24 |
| LogP ≤ 5 | -2.06 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'}, {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'N-nitroso', 'substructure': 'N/A'} |
|---|