C17H35ClN6O4 — CID 70087743
2-[4-amino-5-[4-[2-[(2-methylpropan-2-yl)oxy]ethyl]piperidin-1-yl]-5-oxopentyl]-1-nitroguanidine;hydrochloride (PubChem CID 70087743) has the molecular formula C17H35ClN6O4 and a molecular weight of 422.96 g/mol. Its IUPAC name is 2-[4-amino-5-[4-[2-[(2-methylpropan-2-yl)oxy]ethyl]piperidin-1-yl]-5-oxopentyl]-1-nitroguanidine;hydrochloride.
| Compound Name | 2-[4-amino-5-[4-[2-[(2-methylpropan-2-yl)oxy]ethyl]piperidin-1-yl]-5-oxopentyl]-1-nitroguanidine;hydrochloride |
|---|---|
| PubChem CID | 70087743 |
| Molecular Formula | C17H35ClN6O4 |
| Molecular Weight | 422.96 g/mol |
| Exact Mass | 422.24 |
| IUPAC Name | 2-[4-amino-5-[4-[2-[(2-methylpropan-2-yl)oxy]ethyl]piperidin-1-yl]-5-oxopentyl]-1-nitroguanidine;hydrochloride |
| SMILES | CC(C)(C)OCCC1CCN(C(=O)C(N)CCC/N=C(\N)N[N+](=O)[O-])CC1.Cl |
| InChI | InChI=1S/C17H34N6O4.ClH/c1-17(2,3)27-12-8-13-6-10-22(11-7-13)15(24)14(18)5-4-9-20-16(19)21-23(25)26;/h13-14H,4-12,18H2,1-3H3,(H3,19,20,21);1H |
| InChIKey | LJBOIVUBPDRMGD-UHFFFAOYSA-N |
| XLogP | 1.06 |
| TPSA | 149.11 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 28 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 422.96 |
| LogP ≤ 5 | 1.06 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'}, {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'N-nitroso', 'substructure': 'N/A'} |
|---|