C15H28N6O5 — CID 133109099
ethyl (2S,4S)-1-[2-amino-5-[[amino(nitramido)methylidene]amino]pentanoyl]-4-methylpiperidine-2-carboxylate (PubChem CID 133109099) has the molecular formula C15H28N6O5 and a molecular weight of 372.43 g/mol. Its IUPAC name is ethyl (2S,4S)-1-[2-amino-5-[[amino(nitramido)methylidene]amino]pentanoyl]-4-methylpiperidine-2-carboxylate.
| Compound Name | ethyl (2S,4S)-1-[2-amino-5-[[amino(nitramido)methylidene]amino]pentanoyl]-4-methylpiperidine-2-carboxylate |
|---|---|
| PubChem CID | 133109099 |
| Molecular Formula | C15H28N6O5 |
| Molecular Weight | 372.43 g/mol |
| Exact Mass | 372.21 |
| IUPAC Name | ethyl (2S,4S)-1-[2-amino-5-[[amino(nitramido)methylidene]amino]pentanoyl]-4-methylpiperidine-2-carboxylate |
| SMILES | CCOC(=O)[C@@H]1C[C@@H](C)CCN1C(=O)C(N)CCC/N=C(\N)N[N+](=O)[O-] |
| InChI | InChI=1S/C15H28N6O5/c1-3-26-14(23)12-9-10(2)6-8-20(12)13(22)11(16)5-4-7-18-15(17)19-21(24)25/h10-12H,3-9,16H2,1-2H3,(H3,17,18,19)/t10-,11?,12-/m0/s1 |
| InChIKey | FQJRPNXNFXYTHZ-PRWSFJOGSA-N |
| XLogP | -0.62 |
| TPSA | 166.18 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 26 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 372.43 |
| LogP ≤ 5 | -0.62 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'}, {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'N-nitroso', 'substructure': 'N/A'} |
|---|