C13H21F3N8O5 — CID 73349915
(2S,4R)-1-[(2S)-2-amino-5-[[amino(nitramido)methylidene]amino]pentanoyl]-4-[(2,2,2-trifluoroacetyl)amino]pyrrolidine-2-carboxamide (PubChem CID 73349915) has the molecular formula C13H21F3N8O5 and a molecular weight of 426.36 g/mol. Its IUPAC name is (2S,4R)-1-[(2S)-2-amino-5-[[amino(nitramido)methylidene]amino]pentanoyl]-4-[(2,2,2-trifluoroacetyl)amino]pyrrolidine-2-carboxamide.
| Compound Name | (2S,4R)-1-[(2S)-2-amino-5-[[amino(nitramido)methylidene]amino]pentanoyl]-4-[(2,2,2-trifluoroacetyl)amino]pyrrolidine-2-carboxamide |
|---|---|
| PubChem CID | 73349915 |
| Molecular Formula | C13H21F3N8O5 |
| Molecular Weight | 426.36 g/mol |
| Exact Mass | 426.16 |
| IUPAC Name | (2S,4R)-1-[(2S)-2-amino-5-[[amino(nitramido)methylidene]amino]pentanoyl]-4-[(2,2,2-trifluoroacetyl)amino]pyrrolidine-2-carboxamide |
| SMILES | NC(=O)[C@@H]1C[C@@H](NC(=O)C(F)(F)F)CN1C(=O)[C@@H](N)CCC/N=C(\N)N[N+](=O)[O-] |
| InChI | InChI=1S/C13H21F3N8O5/c14-13(15,16)11(27)21-6-4-8(9(18)25)23(5-6)10(26)7(17)2-1-3-20-12(19)22-24(28)29/h6-8H,1-5,17H2,(H2,18,25)(H,21,27)(H3,19,20,22)/t6-,7+,8+/m1/s1 |
| InChIKey | JWXBKXQVYNNJSR-CSMHCCOUSA-N |
| XLogP | -2.68 |
| TPSA | 212.07 Ų |
| H-Bond Donors | 5 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 29 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 426.36 |
| LogP ≤ 5 | -2.68 |
| H-Bond Donors ≤ 5 | 5 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'}, {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'N-nitroso', 'substructure': 'N/A'} |
|---|