C11H22N8O4 — CID 10065208
(2S)-4-[[(2S)-2-amino-5-[[amino(nitramido)methylidene]amino]pentanoyl]amino]pyrrolidine-2-carboxamide (PubChem CID 10065208) has the molecular formula C11H22N8O4 and a molecular weight of 330.35 g/mol. Its IUPAC name is (2S)-4-[[(2S)-2-amino-5-[[amino(nitramido)methylidene]amino]pentanoyl]amino]pyrrolidine-2-carboxamide.
| Compound Name | (2S)-4-[[(2S)-2-amino-5-[[amino(nitramido)methylidene]amino]pentanoyl]amino]pyrrolidine-2-carboxamide |
|---|---|
| PubChem CID | 10065208 |
| Molecular Formula | C11H22N8O4 |
| Molecular Weight | 330.35 g/mol |
| Exact Mass | 330.18 |
| IUPAC Name | (2S)-4-[[(2S)-2-amino-5-[[amino(nitramido)methylidene]amino]pentanoyl]amino]pyrrolidine-2-carboxamide |
| SMILES | NC(=O)[C@@H]1CC(NC(=O)[C@@H](N)CCC/N=C(\N)N[N+](=O)[O-])CN1 |
| InChI | InChI=1S/C11H22N8O4/c12-7(2-1-3-15-11(14)18-19(22)23)10(21)17-6-4-8(9(13)20)16-5-6/h6-8,16H,1-5,12H2,(H2,13,20)(H,17,21)(H3,14,15,18)/t6?,7-,8-/m0/s1 |
| InChIKey | IUFRDGFKAVLPFZ-ALKRTJFJSA-N |
| XLogP | -3.48 |
| TPSA | 203.79 Ų |
| H-Bond Donors | 6 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 23 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 330.35 |
| LogP ≤ 5 | -3.48 |
| H-Bond Donors ≤ 5 | 6 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'}, {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'N-nitroso', 'substructure': 'N/A'} |
|---|