C20H42N6O3 — CID 135364274
2-amino-5-[[amino(nitramido)methylidene]amino]-N,N-diheptylpentanamide (PubChem CID 135364274) has the molecular formula C20H42N6O3 and a molecular weight of 414.60 g/mol. Its IUPAC name is 2-amino-5-[[amino(nitramido)methylidene]amino]-N,N-diheptylpentanamide.
| Compound Name | 2-amino-5-[[amino(nitramido)methylidene]amino]-N,N-diheptylpentanamide |
|---|---|
| PubChem CID | 135364274 |
| Molecular Formula | C20H42N6O3 |
| Molecular Weight | 414.60 g/mol |
| Exact Mass | 414.33 |
| IUPAC Name | 2-amino-5-[[amino(nitramido)methylidene]amino]-N,N-diheptylpentanamide |
| SMILES | CCCCCCCN(CCCCCCC)C(=O)C(N)CCC/N=C(\N)N[N+](=O)[O-] |
| InChI | InChI=1S/C20H42N6O3/c1-3-5-7-9-11-16-25(17-12-10-8-6-4-2)19(27)18(21)14-13-15-23-20(22)24-26(28)29/h18H,3-17,21H2,1-2H3,(H3,22,23,24) |
| InChIKey | GQBGQJUCINWVET-UHFFFAOYSA-N |
| XLogP | 2.96 |
| TPSA | 139.88 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 18 |
| Heavy Atoms | 29 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 414.60 |
| LogP ≤ 5 | 2.96 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'}, {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'N-nitroso', 'substructure': 'N/A'} |
|---|