C13H29BN6O3 — CID 58864975
(2S)-2-amino-5-[[amino(nitramido)methylidene]amino]-N-[(1R)-1-dimethylboranyl-3-methylbutyl]pentanamide (PubChem CID 58864975) has the molecular formula C13H29BN6O3 and a molecular weight of 328.23 g/mol. Its IUPAC name is (2S)-2-amino-5-[[amino(nitramido)methylidene]amino]-N-[(1R)-1-dimethylboranyl-3-methylbutyl]pentanamide.
| Compound Name | (2S)-2-amino-5-[[amino(nitramido)methylidene]amino]-N-[(1R)-1-dimethylboranyl-3-methylbutyl]pentanamide |
|---|---|
| PubChem CID | 58864975 |
| Molecular Formula | C13H29BN6O3 |
| Molecular Weight | 328.23 g/mol |
| Exact Mass | 328.24 |
| IUPAC Name | (2S)-2-amino-5-[[amino(nitramido)methylidene]amino]-N-[(1R)-1-dimethylboranyl-3-methylbutyl]pentanamide |
| SMILES | CB(C)[C@H](CC(C)C)NC(=O)[C@@H](N)CCC/N=C(\N)N[N+](=O)[O-] |
| InChI | InChI=1S/C13H29BN6O3/c1-9(2)8-11(14(3)4)18-12(21)10(15)6-5-7-17-13(16)19-20(22)23/h9-11H,5-8,15H2,1-4H3,(H,18,21)(H3,16,17,19)/t10-,11-/m0/s1 |
| InChIKey | BIXGSAIBLUXXTE-QWRGUYRKSA-N |
| XLogP | 0.01 |
| TPSA | 148.67 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 23 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 328.23 |
| LogP ≤ 5 | 0.01 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'heavy_metal', 'substructure': 'N/A'}, {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'}, {'alert_name': 'nitro_group', 'substructure': 'N/A'} |
|---|