C21H34N8O6 — CID 46230341
(2S)-N-[(2S)-5-[[amino(nitramido)methylidene]amino]-1-(hydroxyamino)-1-oxopentan-2-yl]-2-[[(2S)-2-amino-3-phenylpropanoyl]amino]-4-methylpentanamide (PubChem CID 46230341) has the molecular formula C21H34N8O6 and a molecular weight of 494.55 g/mol. Its IUPAC name is (2S)-N-[(2S)-5-[[amino(nitramido)methylidene]amino]-1-(hydroxyamino)-1-oxopentan-2-yl]-2-[[(2S)-2-amino-3-phenylpropanoyl]amino]-4-methylpentanamide.
| Compound Name | (2S)-N-[(2S)-5-[[amino(nitramido)methylidene]amino]-1-(hydroxyamino)-1-oxopentan-2-yl]-2-[[(2S)-2-amino-3-phenylpropanoyl]amino]-4-methylpentanamide |
|---|---|
| PubChem CID | 46230341 |
| Molecular Formula | C21H34N8O6 |
| Molecular Weight | 494.55 g/mol |
| Exact Mass | 494.26 |
| IUPAC Name | (2S)-N-[(2S)-5-[[amino(nitramido)methylidene]amino]-1-(hydroxyamino)-1-oxopentan-2-yl]-2-[[(2S)-2-amino-3-phenylpropanoyl]amino]-4-methylpentanamide |
| SMILES | CC(C)C[C@H](NC(=O)[C@@H](N)Cc1ccccc1)C(=O)N[C@@H](CCC/N=C(\N)N[N+](=O)[O-])C(=O)NO |
| InChI | InChI=1S/C21H34N8O6/c1-13(2)11-17(26-18(30)15(22)12-14-7-4-3-5-8-14)19(31)25-16(20(32)28-33)9-6-10-24-21(23)27-29(34)35/h3-5,7-8,13,15-17,33H,6,9-12,22H2,1-2H3,(H,25,31)(H,26,30)(H,28,32)(H3,23,24,27)/t15-,16-,17-/m0/s1 |
| InChIKey | VAIXJDVUSNCVHE-ULQDDVLXSA-N |
| XLogP | -1.05 |
| TPSA | 227.10 Ų |
| H-Bond Donors | 7 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 14 |
| Heavy Atoms | 35 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 494.55 |
| LogP ≤ 5 | -1.05 |
| H-Bond Donors ≤ 5 | 7 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'hydroxamic_acid', 'substructure': 'N/A'}, {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'}, {'alert_name': 'nitro_group', 'substructure': 'N/A'} |
|---|