C21H31N7O7 — CID 11409285
2-[[(2S)-2-[[(2S)-5-[[amino(nitramido)methylidene]amino]-2-benzamidopentanoyl]amino]-4-methylpentanoyl]amino]acetic acid (PubChem CID 11409285) has the molecular formula C21H31N7O7 and a molecular weight of 493.52 g/mol. Its IUPAC name is 2-[[(2S)-2-[[(2S)-5-[[amino(nitramido)methylidene]amino]-2-benzamidopentanoyl]amino]-4-methylpentanoyl]amino]acetic acid.
| Compound Name | 2-[[(2S)-2-[[(2S)-5-[[amino(nitramido)methylidene]amino]-2-benzamidopentanoyl]amino]-4-methylpentanoyl]amino]acetic acid |
|---|---|
| PubChem CID | 11409285 |
| Molecular Formula | C21H31N7O7 |
| Molecular Weight | 493.52 g/mol |
| Exact Mass | 493.23 |
| IUPAC Name | 2-[[(2S)-2-[[(2S)-5-[[amino(nitramido)methylidene]amino]-2-benzamidopentanoyl]amino]-4-methylpentanoyl]amino]acetic acid |
| SMILES | CC(C)C[C@H](NC(=O)[C@H](CCC/N=C(\N)N[N+](=O)[O-])NC(=O)c1ccccc1)C(=O)NCC(=O)O |
| InChI | InChI=1S/C21H31N7O7/c1-13(2)11-16(19(32)24-12-17(29)30)26-20(33)15(9-6-10-23-21(22)27-28(34)35)25-18(31)14-7-4-3-5-8-14/h3-5,7-8,13,15-16H,6,9-12H2,1-2H3,(H,24,32)(H,25,31)(H,26,33)(H,29,30)(H3,22,23,27)/t15-,16-/m0/s1 |
| InChIKey | CAVPVNXHOJLQQS-HOTGVXAUSA-N |
| XLogP | -0.61 |
| TPSA | 218.15 Ų |
| H-Bond Donors | 6 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 14 |
| Heavy Atoms | 35 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 493.52 |
| LogP ≤ 5 | -0.61 |
| H-Bond Donors ≤ 5 | 6 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'}, {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'N-nitroso', 'substructure': 'N/A'} |
|---|