C20H29BrN6O4 — CID 66742500
(2S)-5-[[amino(nitramido)methylidene]amino]-2-[[(E)-3-(2-bromophenyl)prop-2-enoyl]amino]-N-(3-methylbutyl)pentanamide (PubChem CID 66742500) has the molecular formula C20H29BrN6O4 and a molecular weight of 497.39 g/mol. Its IUPAC name is (2S)-5-[[amino(nitramido)methylidene]amino]-2-[[(E)-3-(2-bromophenyl)prop-2-enoyl]amino]-N-(3-methylbutyl)pentanamide.
| Compound Name | (2S)-5-[[amino(nitramido)methylidene]amino]-2-[[(E)-3-(2-bromophenyl)prop-2-enoyl]amino]-N-(3-methylbutyl)pentanamide |
|---|---|
| PubChem CID | 66742500 |
| Molecular Formula | C20H29BrN6O4 |
| Molecular Weight | 497.39 g/mol |
| Exact Mass | 496.14 |
| IUPAC Name | (2S)-5-[[amino(nitramido)methylidene]amino]-2-[[(E)-3-(2-bromophenyl)prop-2-enoyl]amino]-N-(3-methylbutyl)pentanamide |
| SMILES | CC(C)CCNC(=O)[C@H](CCC/N=C(\N)N[N+](=O)[O-])NC(=O)/C=C/c1ccccc1Br |
| InChI | InChI=1S/C20H29BrN6O4/c1-14(2)11-13-23-19(29)17(8-5-12-24-20(22)26-27(30)31)25-18(28)10-9-15-6-3-4-7-16(15)21/h3-4,6-7,9-10,14,17H,5,8,11-13H2,1-2H3,(H,23,29)(H,25,28)(H3,22,24,26)/b10-9+/t17-/m0/s1 |
| InChIKey | KKTIDDYXNSHORW-FVNWOWOISA-N |
| XLogP | 1.99 |
| TPSA | 151.75 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 12 |
| Heavy Atoms | 31 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 497.39 |
| LogP ≤ 5 | 1.99 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'}, {'alert_name': 'nitro_group', 'substructure': 'N/A'} |
|---|