C14H20N6O5 — CID 45481687
N-[(2S)-5-[[amino(nitramido)methylidene]amino]-1-(hydroxyamino)-1-oxopentan-2-yl]-2-methylbenzamide (PubChem CID 45481687) has the molecular formula C14H20N6O5 and a molecular weight of 352.35 g/mol. Its IUPAC name is N-[(2S)-5-[[amino(nitramido)methylidene]amino]-1-(hydroxyamino)-1-oxopentan-2-yl]-2-methylbenzamide.
| Compound Name | N-[(2S)-5-[[amino(nitramido)methylidene]amino]-1-(hydroxyamino)-1-oxopentan-2-yl]-2-methylbenzamide |
|---|---|
| PubChem CID | 45481687 |
| Molecular Formula | C14H20N6O5 |
| Molecular Weight | 352.35 g/mol |
| Exact Mass | 352.15 |
| IUPAC Name | N-[(2S)-5-[[amino(nitramido)methylidene]amino]-1-(hydroxyamino)-1-oxopentan-2-yl]-2-methylbenzamide |
| SMILES | Cc1ccccc1C(=O)N[C@@H](CCC/N=C(\N)N[N+](=O)[O-])C(=O)NO |
| InChI | InChI=1S/C14H20N6O5/c1-9-5-2-3-6-10(9)12(21)17-11(13(22)19-23)7-4-8-16-14(15)18-20(24)25/h2-3,5-6,11,23H,4,7-8H2,1H3,(H,17,21)(H,19,22)(H3,15,16,18)/t11-/m0/s1 |
| InChIKey | PSBQUBXJKCPLEY-NSHDSACASA-N |
| XLogP | -0.52 |
| TPSA | 171.98 Ų |
| H-Bond Donors | 5 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 352.35 |
| LogP ≤ 5 | -0.52 |
| H-Bond Donors ≤ 5 | 5 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'hydroxamic_acid', 'substructure': 'N/A'}, {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'}, {'alert_name': 'nitro_group', 'substructure': 'N/A'} |
|---|