C13H17N7O7 — CID 45481981
N-[(2S)-5-[[amino(nitramido)methylidene]amino]-1-(hydroxyamino)-1-oxopentan-2-yl]-4-nitrobenzamide (PubChem CID 45481981) has the molecular formula C13H17N7O7 and a molecular weight of 383.32 g/mol. Its IUPAC name is N-[(2S)-5-[[amino(nitramido)methylidene]amino]-1-(hydroxyamino)-1-oxopentan-2-yl]-4-nitrobenzamide.
| Compound Name | N-[(2S)-5-[[amino(nitramido)methylidene]amino]-1-(hydroxyamino)-1-oxopentan-2-yl]-4-nitrobenzamide |
|---|---|
| PubChem CID | 45481981 |
| Molecular Formula | C13H17N7O7 |
| Molecular Weight | 383.32 g/mol |
| Exact Mass | 383.12 |
| IUPAC Name | N-[(2S)-5-[[amino(nitramido)methylidene]amino]-1-(hydroxyamino)-1-oxopentan-2-yl]-4-nitrobenzamide |
| SMILES | N/C(=N\CCC[C@H](NC(=O)c1ccc([N+](=O)[O-])cc1)C(=O)NO)N[N+](=O)[O-] |
| InChI | InChI=1S/C13H17N7O7/c14-13(17-20(26)27)15-7-1-2-10(12(22)18-23)16-11(21)8-3-5-9(6-4-8)19(24)25/h3-6,10,23H,1-2,7H2,(H,16,21)(H,18,22)(H3,14,15,17)/t10-/m0/s1 |
| InChIKey | RPBMUZJLIZEHEZ-JTQLQIEISA-N |
| XLogP | -0.93 |
| TPSA | 215.12 Ų |
| H-Bond Donors | 5 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 27 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 383.32 |
| LogP ≤ 5 | -0.93 |
| H-Bond Donors ≤ 5 | 5 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'hydroxamic_acid', 'substructure': 'N/A'}, {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'}, {'alert_name': 'nitro_group', 'substructure': 'N/A'} |
|---|