C22H36BN7O4 — CID 90887625
CID 90887625 (PubChem CID 90887625) has the molecular formula C22H36BN7O4 and a molecular weight of 473.39 g/mol.
| Compound Name | CID 90887625 |
|---|---|
| PubChem CID | 90887625 |
| Molecular Formula | C22H36BN7O4 |
| Molecular Weight | 473.39 g/mol |
| Exact Mass | 473.29 |
| IUPAC Name | — |
| SMILES | [B][C@H](CC(C)C)NC(=O)[C@H](CCC/N=C(\N)N[N+](=O)[O-])NC(=O)c1ccc(N(CC)CC)cc1 |
| InChI | InChI=1S/C22H36BN7O4/c1-5-29(6-2)17-11-9-16(10-12-17)20(31)26-18(21(32)27-19(23)14-15(3)4)8-7-13-25-22(24)28-30(33)34/h9-12,15,18-19H,5-8,13-14H2,1-4H3,(H,26,31)(H,27,32)(H3,24,25,28)/t18-,19-/m0/s1 |
| InChIKey | ZSTKDZPNPGBTHR-OALUTQOASA-N |
| XLogP | 1.16 |
| TPSA | 154.99 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 14 |
| Heavy Atoms | 34 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 473.39 |
| LogP ≤ 5 | 1.16 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'heavy_metal', 'substructure': 'N/A'}, {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'}, {'alert_name': 'nitro_group', 'substructure': 'N/A'} |
|---|