C16H26N8O4 — CID 66741774
N-[(2S)-5-[[amino(nitramido)methylidene]amino]-1-(3-methylbutylamino)-1-oxopentan-2-yl]pyrazine-2-carboxamide (PubChem CID 66741774) has the molecular formula C16H26N8O4 and a molecular weight of 394.44 g/mol. Its IUPAC name is N-[(2S)-5-[[amino(nitramido)methylidene]amino]-1-(3-methylbutylamino)-1-oxopentan-2-yl]pyrazine-2-carboxamide.
| Compound Name | N-[(2S)-5-[[amino(nitramido)methylidene]amino]-1-(3-methylbutylamino)-1-oxopentan-2-yl]pyrazine-2-carboxamide |
|---|---|
| PubChem CID | 66741774 |
| Molecular Formula | C16H26N8O4 |
| Molecular Weight | 394.44 g/mol |
| Exact Mass | 394.21 |
| IUPAC Name | N-[(2S)-5-[[amino(nitramido)methylidene]amino]-1-(3-methylbutylamino)-1-oxopentan-2-yl]pyrazine-2-carboxamide |
| SMILES | CC(C)CCNC(=O)[C@H](CCC/N=C(\N)N[N+](=O)[O-])NC(=O)c1cnccn1 |
| InChI | InChI=1S/C16H26N8O4/c1-11(2)5-7-20-14(25)12(4-3-6-21-16(17)23-24(27)28)22-15(26)13-10-18-8-9-19-13/h8-12H,3-7H2,1-2H3,(H,20,25)(H,22,26)(H3,17,21,23)/t12-/m0/s1 |
| InChIKey | PRNHJDAEBGGZPI-LBPRGKRZSA-N |
| XLogP | -0.39 |
| TPSA | 177.53 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 11 |
| Heavy Atoms | 28 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 394.44 |
| LogP ≤ 5 | -0.39 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'}, {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'N-nitroso', 'substructure': 'N/A'} |
|---|