C22H41N7O6 — CID 66741913
tert-butyl 4-[[(2S)-5-[[amino(nitramido)methylidene]amino]-1-(3-methylbutylamino)-1-oxopentan-2-yl]carbamoyl]piperidine-1-carboxylate (PubChem CID 66741913) has the molecular formula C22H41N7O6 and a molecular weight of 499.61 g/mol. Its IUPAC name is tert-butyl 4-[[(2S)-5-[[amino(nitramido)methylidene]amino]-1-(3-methylbutylamino)-1-oxopentan-2-yl]carbamoyl]piperidine-1-carboxylate.
| Compound Name | tert-butyl 4-[[(2S)-5-[[amino(nitramido)methylidene]amino]-1-(3-methylbutylamino)-1-oxopentan-2-yl]carbamoyl]piperidine-1-carboxylate |
|---|---|
| PubChem CID | 66741913 |
| Molecular Formula | C22H41N7O6 |
| Molecular Weight | 499.61 g/mol |
| Exact Mass | 499.31 |
| IUPAC Name | tert-butyl 4-[[(2S)-5-[[amino(nitramido)methylidene]amino]-1-(3-methylbutylamino)-1-oxopentan-2-yl]carbamoyl]piperidine-1-carboxylate |
| SMILES | CC(C)CCNC(=O)[C@H](CCC/N=C(\N)N[N+](=O)[O-])NC(=O)C1CCN(C(=O)OC(C)(C)C)CC1 |
| InChI | InChI=1S/C22H41N7O6/c1-15(2)8-12-24-19(31)17(7-6-11-25-20(23)27-29(33)34)26-18(30)16-9-13-28(14-10-16)21(32)35-22(3,4)5/h15-17H,6-14H2,1-5H3,(H,24,31)(H,26,30)(H3,23,25,27)/t17-/m0/s1 |
| InChIKey | RXLQZMDBVPXJLJ-KRWDZBQOSA-N |
| XLogP | 1.16 |
| TPSA | 181.29 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 11 |
| Heavy Atoms | 35 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 499.61 |
| LogP ≤ 5 | 1.16 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'}, {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'N-nitroso', 'substructure': 'N/A'} |
|---|