C26H43BrCl2N8O6 — CID 71437256
ethyl 2-[[2-[[2-amino-3-[bis(2-chloroethyl)amino]-3-phenylpropanoyl]amino]-5-[[amino(nitramido)methylidene]amino]pentanoyl]amino]pentanoate;hydrobromide (PubChem CID 71437256) has the molecular formula C26H43BrCl2N8O6 and a molecular weight of 714.49 g/mol. Its IUPAC name is ethyl 2-[[2-[[2-amino-3-[bis(2-chloroethyl)amino]-3-phenylpropanoyl]amino]-5-[[amino(nitramido)methylidene]amino]pentanoyl]amino]pentanoate;hydrobromide.
| Compound Name | ethyl 2-[[2-[[2-amino-3-[bis(2-chloroethyl)amino]-3-phenylpropanoyl]amino]-5-[[amino(nitramido)methylidene]amino]pentanoyl]amino]pentanoate;hydrobromide |
|---|---|
| PubChem CID | 71437256 |
| Molecular Formula | C26H43BrCl2N8O6 |
| Molecular Weight | 714.49 g/mol |
| Exact Mass | 712.19 |
| IUPAC Name | ethyl 2-[[2-[[2-amino-3-[bis(2-chloroethyl)amino]-3-phenylpropanoyl]amino]-5-[[amino(nitramido)methylidene]amino]pentanoyl]amino]pentanoate;hydrobromide |
| SMILES | Br.CCCC(NC(=O)C(CCC/N=C(\N)N[N+](=O)[O-])NC(=O)C(N)C(c1ccccc1)N(CCCl)CCCl)C(=O)OCC |
| InChI | InChI=1S/C26H42Cl2N8O6.BrH/c1-3-9-20(25(39)42-4-2)33-23(37)19(12-8-15-31-26(30)34-36(40)41)32-24(38)21(29)22(18-10-6-5-7-11-18)35(16-13-27)17-14-28;/h5-7,10-11,19-22H,3-4,8-9,12-17,29H2,1-2H3,(H,32,38)(H,33,37)(H3,30,31,34);1H |
| InChIKey | ODJVXBXZQHPSNS-UHFFFAOYSA-N |
| XLogP | 1.62 |
| TPSA | 207.31 Ų |
| H-Bond Donors | 5 |
| H-Bond Acceptors | 9 |
| Rotatable Bonds | 20 |
| Heavy Atoms | 43 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 714.49 |
| LogP ≤ 5 | 1.62 |
| H-Bond Donors ≤ 5 | 5 |
| H-Bond Acceptors ≤ 10 | 9 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'alkyl_halide', 'substructure': 'N/A'}, {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'}, {'alert_name': 'nitro_group', 'substructure': 'N/A'} |
|---|