C20H32N8O6 — CID 46230340
(2S)-5-[[amino(nitramido)methylidene]amino]-2-[[(2S)-2-[[(2S)-2-amino-3-phenylpropanoyl]amino]-3-methylbutanoyl]amino]-N-hydroxypentanamide (PubChem CID 46230340) has the molecular formula C20H32N8O6 and a molecular weight of 480.53 g/mol. Its IUPAC name is (2S)-5-[[amino(nitramido)methylidene]amino]-2-[[(2S)-2-[[(2S)-2-amino-3-phenylpropanoyl]amino]-3-methylbutanoyl]amino]-N-hydroxypentanamide.
| Compound Name | (2S)-5-[[amino(nitramido)methylidene]amino]-2-[[(2S)-2-[[(2S)-2-amino-3-phenylpropanoyl]amino]-3-methylbutanoyl]amino]-N-hydroxypentanamide |
|---|---|
| PubChem CID | 46230340 |
| Molecular Formula | C20H32N8O6 |
| Molecular Weight | 480.53 g/mol |
| Exact Mass | 480.24 |
| IUPAC Name | (2S)-5-[[amino(nitramido)methylidene]amino]-2-[[(2S)-2-[[(2S)-2-amino-3-phenylpropanoyl]amino]-3-methylbutanoyl]amino]-N-hydroxypentanamide |
| SMILES | CC(C)[C@H](NC(=O)[C@@H](N)Cc1ccccc1)C(=O)N[C@@H](CCC/N=C(\N)N[N+](=O)[O-])C(=O)NO |
| InChI | InChI=1S/C20H32N8O6/c1-12(2)16(25-17(29)14(21)11-13-7-4-3-5-8-13)19(31)24-15(18(30)27-32)9-6-10-23-20(22)26-28(33)34/h3-5,7-8,12,14-16,32H,6,9-11,21H2,1-2H3,(H,24,31)(H,25,29)(H,27,30)(H3,22,23,26)/t14-,15-,16-/m0/s1 |
| InChIKey | BWUASXBEWIUMRX-JYJNAYRXSA-N |
| XLogP | -1.44 |
| TPSA | 227.10 Ų |
| H-Bond Donors | 7 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 13 |
| Heavy Atoms | 34 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 480.53 |
| LogP ≤ 5 | -1.44 |
| H-Bond Donors ≤ 5 | 7 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'hydroxamic_acid', 'substructure': 'N/A'}, {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'}, {'alert_name': 'nitro_group', 'substructure': 'N/A'} |
|---|