C27H38N6O3 — CID 22706890
2-[(2-amino-3-phenylpropanoyl)amino]-N-[5-(diaminomethylideneamino)-1-(2-methylphenyl)-1-oxopentan-2-yl]-3-methylbutanamide (PubChem CID 22706890) has the molecular formula C27H38N6O3 and a molecular weight of 494.64 g/mol. Its IUPAC name is 2-[(2-amino-3-phenylpropanoyl)amino]-N-[5-(diaminomethylideneamino)-1-(2-methylphenyl)-1-oxopentan-2-yl]-3-methylbutanamide.
| Compound Name | 2-[(2-amino-3-phenylpropanoyl)amino]-N-[5-(diaminomethylideneamino)-1-(2-methylphenyl)-1-oxopentan-2-yl]-3-methylbutanamide |
|---|---|
| PubChem CID | 22706890 |
| Molecular Formula | C27H38N6O3 |
| Molecular Weight | 494.64 g/mol |
| Exact Mass | 494.30 |
| IUPAC Name | 2-[(2-amino-3-phenylpropanoyl)amino]-N-[5-(diaminomethylideneamino)-1-(2-methylphenyl)-1-oxopentan-2-yl]-3-methylbutanamide |
| SMILES | Cc1ccccc1C(=O)C(CCCN=C(N)N)NC(=O)C(NC(=O)C(N)Cc1ccccc1)C(C)C |
| InChI | InChI=1S/C27H38N6O3/c1-17(2)23(33-25(35)21(28)16-19-11-5-4-6-12-19)26(36)32-22(14-9-15-31-27(29)30)24(34)20-13-8-7-10-18(20)3/h4-8,10-13,17,21-23H,9,14-16,28H2,1-3H3,(H,32,36)(H,33,35)(H4,29,30,31) |
| InChIKey | JZARJJXRDMPLRS-UHFFFAOYSA-N |
| XLogP | 1.43 |
| TPSA | 165.69 Ų |
| H-Bond Donors | 5 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 13 |
| Heavy Atoms | 36 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 494.64 |
| LogP ≤ 5 | 1.43 |
| H-Bond Donors ≤ 5 | 5 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'} |
|---|