C31H42N8O9 — CID 42605265
benzyl (2S)-2-[[(2S)-2-[[2-[[(2S)-2-amino-5-[[amino(nitramido)methylidene]amino]pentanoyl]amino]acetyl]amino]-4-oxo-4-phenylmethoxybutanoyl]amino]-3-methylbutanoate (PubChem CID 42605265) has the molecular formula C31H42N8O9 and a molecular weight of 670.72 g/mol. Its IUPAC name is benzyl (2S)-2-[[(2S)-2-[[2-[[(2S)-2-amino-5-[[amino(nitramido)methylidene]amino]pentanoyl]amino]acetyl]amino]-4-oxo-4-phenylmethoxybutanoyl]amino]-3-methylbutanoate.
| Compound Name | benzyl (2S)-2-[[(2S)-2-[[2-[[(2S)-2-amino-5-[[amino(nitramido)methylidene]amino]pentanoyl]amino]acetyl]amino]-4-oxo-4-phenylmethoxybutanoyl]amino]-3-methylbutanoate |
|---|---|
| PubChem CID | 42605265 |
| Molecular Formula | C31H42N8O9 |
| Molecular Weight | 670.72 g/mol |
| Exact Mass | 670.31 |
| IUPAC Name | benzyl (2S)-2-[[(2S)-2-[[2-[[(2S)-2-amino-5-[[amino(nitramido)methylidene]amino]pentanoyl]amino]acetyl]amino]-4-oxo-4-phenylmethoxybutanoyl]amino]-3-methylbutanoate |
| SMILES | CC(C)[C@H](NC(=O)[C@H](CC(=O)OCc1ccccc1)NC(=O)CNC(=O)[C@@H](N)CCC/N=C(\N)N[N+](=O)[O-])C(=O)OCc1ccccc1 |
| InChI | InChI=1S/C31H42N8O9/c1-20(2)27(30(44)48-19-22-12-7-4-8-13-22)37-29(43)24(16-26(41)47-18-21-10-5-3-6-11-21)36-25(40)17-35-28(42)23(32)14-9-15-34-31(33)38-39(45)46/h3-8,10-13,20,23-24,27H,9,14-19,32H2,1-2H3,(H,35,42)(H,36,40)(H,37,43)(H3,33,34,38)/t23-,24-,27-/m0/s1 |
| InChIKey | AXRFRIPVDGKBGJ-DPZBCOQUSA-N |
| XLogP | -0.19 |
| TPSA | 259.47 Ų |
| H-Bond Donors | 6 |
| H-Bond Acceptors | 11 |
| Rotatable Bonds | 19 |
| Heavy Atoms | 48 |
| Complexity | — |
3 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 670.72 |
| LogP ≤ 5 | -0.19 |
| H-Bond Donors ≤ 5 | 6 |
| H-Bond Acceptors ≤ 10 | 11 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'}, {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'N-nitroso', 'substructure': 'N/A'} |
|---|