C20H32N6O5 — CID 10836677
benzyl (3S)-3-amino-3-[9-[[amino(nitramido)methylidene]amino]nonanoylamino]propanoate (PubChem CID 10836677) has the molecular formula C20H32N6O5 and a molecular weight of 436.51 g/mol. Its IUPAC name is benzyl (3S)-3-amino-3-[9-[[amino(nitramido)methylidene]amino]nonanoylamino]propanoate.
| Compound Name | benzyl (3S)-3-amino-3-[9-[[amino(nitramido)methylidene]amino]nonanoylamino]propanoate |
|---|---|
| PubChem CID | 10836677 |
| Molecular Formula | C20H32N6O5 |
| Molecular Weight | 436.51 g/mol |
| Exact Mass | 436.24 |
| IUPAC Name | benzyl (3S)-3-amino-3-[9-[[amino(nitramido)methylidene]amino]nonanoylamino]propanoate |
| SMILES | N/C(=N\CCCCCCCCC(=O)N[C@H](N)CC(=O)OCc1ccccc1)N[N+](=O)[O-] |
| InChI | InChI=1S/C20H32N6O5/c21-17(14-19(28)31-15-16-10-6-5-7-11-16)24-18(27)12-8-3-1-2-4-9-13-23-20(22)25-26(29)30/h5-7,10-11,17H,1-4,8-9,12-15,21H2,(H,24,27)(H3,22,23,25)/t17-/m0/s1 |
| InChIKey | AHZBXZVWAMVYFO-KRWDZBQOSA-N |
| XLogP | 1.35 |
| TPSA | 174.97 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 15 |
| Heavy Atoms | 31 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 436.51 |
| LogP ≤ 5 | 1.35 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'het-C-het_not_in_ring', 'substructure': 'N/A'}, {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'}, {'alert_name': 'nitro_group', 'substructure': 'N/A'} |
|---|