C28H46N10O8 — CID 135485856
benzyl (3R)-3-[7-[[(Z)-N'-nitrocarbamimidoyl]amino]heptanoylamino]-3-[9-[[(E)-N'-nitrocarbamimidoyl]amino]nonanoylamino]propanoate (PubChem CID 135485856) has the molecular formula C28H46N10O8 and a molecular weight of 650.74 g/mol. Its IUPAC name is benzyl (3R)-3-[7-[[(Z)-N'-nitrocarbamimidoyl]amino]heptanoylamino]-3-[9-[[(E)-N'-nitrocarbamimidoyl]amino]nonanoylamino]propanoate.
| Compound Name | benzyl (3R)-3-[7-[[(Z)-N'-nitrocarbamimidoyl]amino]heptanoylamino]-3-[9-[[(E)-N'-nitrocarbamimidoyl]amino]nonanoylamino]propanoate |
|---|---|
| PubChem CID | 135485856 |
| Molecular Formula | C28H46N10O8 |
| Molecular Weight | 650.74 g/mol |
| Exact Mass | 650.35 |
| IUPAC Name | benzyl (3R)-3-[7-[[(Z)-N'-nitrocarbamimidoyl]amino]heptanoylamino]-3-[9-[[(E)-N'-nitrocarbamimidoyl]amino]nonanoylamino]propanoate |
| SMILES | N/C(=N/[N+](=O)[O-])NCCCCCCC(=O)N[C@H](CC(=O)OCc1ccccc1)NC(=O)CCCCCCCCN/C(N)=N/[N+](=O)[O-] |
| InChI | InChI=1S/C28H46N10O8/c29-27(35-37(42)43)31-18-12-5-2-1-3-10-16-24(39)33-23(20-26(41)46-21-22-14-8-7-9-15-22)34-25(40)17-11-4-6-13-19-32-28(30)36-38(44)45/h7-9,14-15,23H,1-6,10-13,16-21H2,(H,33,39)(H,34,40)(H3,29,31,35)(H3,30,32,36)/t23-/m1/s1 |
| InChIKey | YHOLTKOYRSNVMS-HSZRJFAPSA-N |
| XLogP | 1.55 |
| TPSA | 271.60 Ų |
| H-Bond Donors | 6 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 24 |
| Heavy Atoms | 46 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 650.74 |
| LogP ≤ 5 | 1.55 |
| H-Bond Donors ≤ 5 | 6 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'het-C-het_not_in_ring', 'substructure': 'N/A'}, {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'}, {'alert_name': 'nitro_group', 'substructure': 'N/A'} |
|---|