C20H30N2O5 — CID 67831339
6-[5-(phenylmethoxycarbonylamino)hexanoylamino]hexanoic acid (PubChem CID 67831339) has the molecular formula C20H30N2O5 and a molecular weight of 378.47 g/mol. Its IUPAC name is 6-[5-(phenylmethoxycarbonylamino)hexanoylamino]hexanoic acid.
| Compound Name | 6-[5-(phenylmethoxycarbonylamino)hexanoylamino]hexanoic acid |
|---|---|
| PubChem CID | 67831339 |
| Molecular Formula | C20H30N2O5 |
| Molecular Weight | 378.47 g/mol |
| Exact Mass | 378.22 |
| IUPAC Name | 6-[5-(phenylmethoxycarbonylamino)hexanoylamino]hexanoic acid |
| SMILES | CC(CCCC(=O)NCCCCCC(=O)O)NC(=O)OCc1ccccc1 |
| InChI | InChI=1S/C20H30N2O5/c1-16(22-20(26)27-15-17-10-4-2-5-11-17)9-8-12-18(23)21-14-7-3-6-13-19(24)25/h2,4-5,10-11,16H,3,6-9,12-15H2,1H3,(H,21,23)(H,22,26)(H,24,25) |
| InChIKey | JCPAUCGMJBOFIH-UHFFFAOYSA-N |
| XLogP | 3.23 |
| TPSA | 104.73 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 13 |
| Heavy Atoms | 27 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 378.47 |
| LogP ≤ 5 | 3.23 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|