C26H38N4O9 — CID 70864893
6-[[2-[[2-(5-carboxypentylamino)-2-oxoethyl]-[2-(phenylmethoxycarbonylamino)acetyl]amino]acetyl]amino]hexanoic acid (PubChem CID 70864893) has the molecular formula C26H38N4O9 and a molecular weight of 550.61 g/mol. Its IUPAC name is 6-[[2-[[2-(5-carboxypentylamino)-2-oxoethyl]-[2-(phenylmethoxycarbonylamino)acetyl]amino]acetyl]amino]hexanoic acid.
| Compound Name | 6-[[2-[[2-(5-carboxypentylamino)-2-oxoethyl]-[2-(phenylmethoxycarbonylamino)acetyl]amino]acetyl]amino]hexanoic acid |
|---|---|
| PubChem CID | 70864893 |
| Molecular Formula | C26H38N4O9 |
| Molecular Weight | 550.61 g/mol |
| Exact Mass | 550.26 |
| IUPAC Name | 6-[[2-[[2-(5-carboxypentylamino)-2-oxoethyl]-[2-(phenylmethoxycarbonylamino)acetyl]amino]acetyl]amino]hexanoic acid |
| SMILES | O=C(O)CCCCCNC(=O)CN(CC(=O)NCCCCCC(=O)O)C(=O)CNC(=O)OCc1ccccc1 |
| InChI | InChI=1S/C26H38N4O9/c31-21(27-14-8-2-6-12-24(34)35)17-30(18-22(32)28-15-9-3-7-13-25(36)37)23(33)16-29-26(38)39-19-20-10-4-1-5-11-20/h1,4-5,10-11H,2-3,6-9,12-19H2,(H,27,31)(H,28,32)(H,29,38)(H,34,35)(H,36,37) |
| InChIKey | CAPRSWORBQSQCS-UHFFFAOYSA-N |
| XLogP | 1.26 |
| TPSA | 191.44 Ų |
| H-Bond Donors | 5 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 20 |
| Heavy Atoms | 39 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 550.61 |
| LogP ≤ 5 | 1.26 |
| H-Bond Donors ≤ 5 | 5 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|