C24H28N2O7 — CID 67746829
(3S)-2-benzyl-4-(4-carboxybutylamino)-4-oxo-3-(phenylmethoxycarbonylamino)butanoic acid (PubChem CID 67746829) has the molecular formula C24H28N2O7 and a molecular weight of 456.50 g/mol. Its IUPAC name is (3S)-2-benzyl-4-(4-carboxybutylamino)-4-oxo-3-(phenylmethoxycarbonylamino)butanoic acid.
| Compound Name | (3S)-2-benzyl-4-(4-carboxybutylamino)-4-oxo-3-(phenylmethoxycarbonylamino)butanoic acid |
|---|---|
| PubChem CID | 67746829 |
| Molecular Formula | C24H28N2O7 |
| Molecular Weight | 456.50 g/mol |
| Exact Mass | 456.19 |
| IUPAC Name | (3S)-2-benzyl-4-(4-carboxybutylamino)-4-oxo-3-(phenylmethoxycarbonylamino)butanoic acid |
| SMILES | O=C(O)CCCCNC(=O)[C@@H](NC(=O)OCc1ccccc1)C(Cc1ccccc1)C(=O)O |
| InChI | InChI=1S/C24H28N2O7/c27-20(28)13-7-8-14-25-22(29)21(19(23(30)31)15-17-9-3-1-4-10-17)26-24(32)33-16-18-11-5-2-6-12-18/h1-6,9-12,19,21H,7-8,13-16H2,(H,25,29)(H,26,32)(H,27,28)(H,30,31)/t19?,21-/m0/s1 |
| InChIKey | UGXYHVWRMFHPCA-QWAKEFERSA-N |
| XLogP | 2.60 |
| TPSA | 142.03 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 13 |
| Heavy Atoms | 33 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 456.50 |
| LogP ≤ 5 | 2.60 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|