C44H54N4O6 — CID 99653330
benzyl N-[(2S)-1-oxo-3-phenyl-1-[10-[[(2R)-3-phenyl-2-(phenylmethoxycarbonylamino)propanoyl]amino]decylamino]propan-2-yl]carbamate (PubChem CID 99653330) has the molecular formula C44H54N4O6 and a molecular weight of 734.94 g/mol. Its IUPAC name is benzyl N-[(2S)-1-oxo-3-phenyl-1-[10-[[(2R)-3-phenyl-2-(phenylmethoxycarbonylamino)propanoyl]amino]decylamino]propan-2-yl]carbamate.
| Compound Name | benzyl N-[(2S)-1-oxo-3-phenyl-1-[10-[[(2R)-3-phenyl-2-(phenylmethoxycarbonylamino)propanoyl]amino]decylamino]propan-2-yl]carbamate |
|---|---|
| PubChem CID | 99653330 |
| Molecular Formula | C44H54N4O6 |
| Molecular Weight | 734.94 g/mol |
| Exact Mass | 734.40 |
| IUPAC Name | benzyl N-[(2S)-1-oxo-3-phenyl-1-[10-[[(2R)-3-phenyl-2-(phenylmethoxycarbonylamino)propanoyl]amino]decylamino]propan-2-yl]carbamate |
| SMILES | O=C(N[C@@H](Cc1ccccc1)C(=O)NCCCCCCCCCCNC(=O)[C@@H](Cc1ccccc1)NC(=O)OCc1ccccc1)OCc1ccccc1 |
| InChI | InChI=1S/C44H54N4O6/c49-41(39(31-35-21-11-7-12-22-35)47-43(51)53-33-37-25-15-9-16-26-37)45-29-19-5-3-1-2-4-6-20-30-46-42(50)40(32-36-23-13-8-14-24-36)48-44(52)54-34-38-27-17-10-18-28-38/h7-18,21-28,39-40H,1-6,19-20,29-34H2,(H,45,49)(H,46,50)(H,47,51)(H,48,52)/t39-,40+ |
| InChIKey | JWYLJVRSQPOUJG-LQDDJWCHSA-N |
| XLogP | 7.41 |
| TPSA | 134.86 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 23 |
| Heavy Atoms | 54 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 734.94 |
| LogP ≤ 5 | 7.41 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|