C19H24N2O6P+ — CID 70147740
benzyl N-[(2S)-1-(ethylamino)-1-oxo-3-phenylpropan-2-yl]carbamate;dihydroxy(oxo)phosphanium (PubChem CID 70147740) has the molecular formula C19H24N2O6P+ and a molecular weight of 407.38 g/mol. Its IUPAC name is benzyl N-[(2S)-1-(ethylamino)-1-oxo-3-phenylpropan-2-yl]carbamate;dihydroxy(oxo)phosphanium.
| Compound Name | benzyl N-[(2S)-1-(ethylamino)-1-oxo-3-phenylpropan-2-yl]carbamate;dihydroxy(oxo)phosphanium |
|---|---|
| PubChem CID | 70147740 |
| Molecular Formula | C19H24N2O6P+ |
| Molecular Weight | 407.38 g/mol |
| Exact Mass | 407.14 |
| IUPAC Name | benzyl N-[(2S)-1-(ethylamino)-1-oxo-3-phenylpropan-2-yl]carbamate;dihydroxy(oxo)phosphanium |
| SMILES | CCNC(=O)[C@H](Cc1ccccc1)NC(=O)OCc1ccccc1.O=[P+](O)O |
| InChI | InChI=1S/C19H22N2O3.HO3P/c1-2-20-18(22)17(13-15-9-5-3-6-10-15)21-19(23)24-14-16-11-7-4-8-12-16;1-4(2)3/h3-12,17H,2,13-14H2,1H3,(H,20,22)(H,21,23);(H-,1,2,3)/p+1/t17-;/m0./s1 |
| InChIKey | XRVULMJCJKUUGS-LMOVPXPDSA-O |
| XLogP | 2.29 |
| TPSA | 124.96 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 28 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 407.38 |
| LogP ≤ 5 | 2.29 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'phosphor', 'substructure': 'N/A'} |
|---|