C25H35N3O3 — CID 71211470
benzyl N-[(2S)-1-[4-(diethylamino)butylamino]-1-oxo-3-phenylpropan-2-yl]carbamate (PubChem CID 71211470) has the molecular formula C25H35N3O3 and a molecular weight of 425.57 g/mol. Its IUPAC name is benzyl N-[(2S)-1-[4-(diethylamino)butylamino]-1-oxo-3-phenylpropan-2-yl]carbamate.
| Compound Name | benzyl N-[(2S)-1-[4-(diethylamino)butylamino]-1-oxo-3-phenylpropan-2-yl]carbamate |
|---|---|
| PubChem CID | 71211470 |
| Molecular Formula | C25H35N3O3 |
| Molecular Weight | 425.57 g/mol |
| Exact Mass | 425.27 |
| IUPAC Name | benzyl N-[(2S)-1-[4-(diethylamino)butylamino]-1-oxo-3-phenylpropan-2-yl]carbamate |
| SMILES | CCN(CC)CCCCNC(=O)[C@H](Cc1ccccc1)NC(=O)OCc1ccccc1 |
| InChI | InChI=1S/C25H35N3O3/c1-3-28(4-2)18-12-11-17-26-24(29)23(19-21-13-7-5-8-14-21)27-25(30)31-20-22-15-9-6-10-16-22/h5-10,13-16,23H,3-4,11-12,17-20H2,1-2H3,(H,26,29)(H,27,30)/t23-/m0/s1 |
| InChIKey | IDXBNNCUBZXITN-QHCPKHFHSA-N |
| XLogP | 3.76 |
| TPSA | 70.67 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 13 |
| Heavy Atoms | 31 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 425.57 |
| LogP ≤ 5 | 3.76 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|