C19H22N6O6 — CID 25155211
(2S)-5-[[amino(nitramido)methylidene]amino]-2-[(1-benzyl-2-oxopyridine-3-carbonyl)amino]pentanoic acid (PubChem CID 25155211) has the molecular formula C19H22N6O6 and a molecular weight of 430.42 g/mol. Its IUPAC name is (2S)-5-[[amino(nitramido)methylidene]amino]-2-[(1-benzyl-2-oxopyridine-3-carbonyl)amino]pentanoic acid.
| Compound Name | (2S)-5-[[amino(nitramido)methylidene]amino]-2-[(1-benzyl-2-oxopyridine-3-carbonyl)amino]pentanoic acid |
|---|---|
| PubChem CID | 25155211 |
| Molecular Formula | C19H22N6O6 |
| Molecular Weight | 430.42 g/mol |
| Exact Mass | 430.16 |
| IUPAC Name | (2S)-5-[[amino(nitramido)methylidene]amino]-2-[(1-benzyl-2-oxopyridine-3-carbonyl)amino]pentanoic acid |
| SMILES | N/C(=N\CCC[C@H](NC(=O)c1cccn(Cc2ccccc2)c1=O)C(=O)O)N[N+](=O)[O-] |
| InChI | InChI=1S/C19H22N6O6/c20-19(23-25(30)31)21-10-4-9-15(18(28)29)22-16(26)14-8-5-11-24(17(14)27)12-13-6-2-1-3-7-13/h1-3,5-8,11,15H,4,9-10,12H2,(H,22,26)(H,28,29)(H3,20,21,23)/t15-/m0/s1 |
| InChIKey | TVBMNGMAFUDDHB-HNNXBMFYSA-N |
| XLogP | -0.04 |
| TPSA | 181.95 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 31 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 430.42 |
| LogP ≤ 5 | -0.04 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'}, {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'N-nitroso', 'substructure': 'N/A'} |
|---|