C18H20N2O4 — CID 97338787
(4S)-4-[(1-benzyl-2-oxopyridine-3-carbonyl)amino]pentanoic acid (PubChem CID 97338787) has the molecular formula C18H20N2O4 and a molecular weight of 328.37 g/mol. Its IUPAC name is (4S)-4-[(1-benzyl-2-oxopyridine-3-carbonyl)amino]pentanoic acid.
| Compound Name | (4S)-4-[(1-benzyl-2-oxopyridine-3-carbonyl)amino]pentanoic acid |
|---|---|
| PubChem CID | 97338787 |
| Molecular Formula | C18H20N2O4 |
| Molecular Weight | 328.37 g/mol |
| Exact Mass | 328.14 |
| IUPAC Name | (4S)-4-[(1-benzyl-2-oxopyridine-3-carbonyl)amino]pentanoic acid |
| SMILES | C[C@@H](CCC(=O)O)NC(=O)c1cccn(Cc2ccccc2)c1=O |
| InChI | InChI=1S/C18H20N2O4/c1-13(9-10-16(21)22)19-17(23)15-8-5-11-20(18(15)24)12-14-6-3-2-4-7-14/h2-8,11,13H,9-10,12H2,1H3,(H,19,23)(H,21,22)/t13-/m0/s1 |
| InChIKey | BLVUKDVVPSFQAS-ZDUSSCGKSA-N |
| XLogP | 1.88 |
| TPSA | 88.40 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 328.37 |
| LogP ≤ 5 | 1.88 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |