C16H19N3O3 — CID 97338785
(4S)-4-[(1-benzylpyrazole-4-carbonyl)amino]pentanoic acid (PubChem CID 97338785) has the molecular formula C16H19N3O3 and a molecular weight of 301.35 g/mol. Its IUPAC name is (4S)-4-[(1-benzylpyrazole-4-carbonyl)amino]pentanoic acid.
| Compound Name | (4S)-4-[(1-benzylpyrazole-4-carbonyl)amino]pentanoic acid |
|---|---|
| PubChem CID | 97338785 |
| Molecular Formula | C16H19N3O3 |
| Molecular Weight | 301.35 g/mol |
| Exact Mass | 301.14 |
| IUPAC Name | (4S)-4-[(1-benzylpyrazole-4-carbonyl)amino]pentanoic acid |
| SMILES | C[C@@H](CCC(=O)O)NC(=O)c1cnn(Cc2ccccc2)c1 |
| InChI | InChI=1S/C16H19N3O3/c1-12(7-8-15(20)21)18-16(22)14-9-17-19(11-14)10-13-5-3-2-4-6-13/h2-6,9,11-12H,7-8,10H2,1H3,(H,18,22)(H,20,21)/t12-/m0/s1 |
| InChIKey | MJIQNKCCMTYNTL-LBPRGKRZSA-N |
| XLogP | 1.91 |
| TPSA | 84.22 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 22 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 301.35 |
| LogP ≤ 5 | 1.91 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |