C23H26N4O2 — CID 86996216
1-benzyl-N-[[3-(butan-2-ylcarbamoyl)phenyl]methyl]pyrazole-4-carboxamide (PubChem CID 86996216) has the molecular formula C23H26N4O2 and a molecular weight of 390.49 g/mol. Its IUPAC name is 1-benzyl-N-[[3-(butan-2-ylcarbamoyl)phenyl]methyl]pyrazole-4-carboxamide.
| Compound Name | 1-benzyl-N-[[3-(butan-2-ylcarbamoyl)phenyl]methyl]pyrazole-4-carboxamide |
|---|---|
| PubChem CID | 86996216 |
| Molecular Formula | C23H26N4O2 |
| Molecular Weight | 390.49 g/mol |
| Exact Mass | 390.21 |
| IUPAC Name | 1-benzyl-N-[[3-(butan-2-ylcarbamoyl)phenyl]methyl]pyrazole-4-carboxamide |
| SMILES | CCC(C)NC(=O)c1cccc(CNC(=O)c2cnn(Cc3ccccc3)c2)c1 |
| InChI | InChI=1S/C23H26N4O2/c1-3-17(2)26-23(29)20-11-7-10-19(12-20)13-24-22(28)21-14-25-27(16-21)15-18-8-5-4-6-9-18/h4-12,14,16-17H,3,13,15H2,1-2H3,(H,24,28)(H,26,29) |
| InChIKey | SEDBFZWIOAICOP-UHFFFAOYSA-N |
| XLogP | 3.39 |
| TPSA | 76.02 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 29 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 390.49 |
| LogP ≤ 5 | 3.39 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |