C23H25N3O4 — CID 55794894
N-butan-2-yl-3-[[2-(1,3-dioxoisoindol-2-yl)propanoylamino]methyl]benzamide (PubChem CID 55794894) has the molecular formula C23H25N3O4 and a molecular weight of 407.47 g/mol. Its IUPAC name is N-butan-2-yl-3-[[2-(1,3-dioxoisoindol-2-yl)propanoylamino]methyl]benzamide.
| Compound Name | N-butan-2-yl-3-[[2-(1,3-dioxoisoindol-2-yl)propanoylamino]methyl]benzamide |
|---|---|
| PubChem CID | 55794894 |
| Molecular Formula | C23H25N3O4 |
| Molecular Weight | 407.47 g/mol |
| Exact Mass | 407.18 |
| IUPAC Name | N-butan-2-yl-3-[[2-(1,3-dioxoisoindol-2-yl)propanoylamino]methyl]benzamide |
| SMILES | CCC(C)NC(=O)c1cccc(CNC(=O)C(C)N2C(=O)c3ccccc3C2=O)c1 |
| InChI | InChI=1S/C23H25N3O4/c1-4-14(2)25-21(28)17-9-7-8-16(12-17)13-24-20(27)15(3)26-22(29)18-10-5-6-11-19(18)23(26)30/h5-12,14-15H,4,13H2,1-3H3,(H,24,27)(H,25,28) |
| InChIKey | ILSMIJAEWUBOJT-UHFFFAOYSA-N |
| XLogP | 2.52 |
| TPSA | 95.58 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 30 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 407.47 |
| LogP ≤ 5 | 2.52 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'phthalimide', 'substructure': 'N/A'} |
|---|