C17H28ClN3O2 — CID 119287338
3-[(2-aminopentanoylamino)methyl]-N-butan-2-ylbenzamide;hydrochloride (PubChem CID 119287338) has the molecular formula C17H28ClN3O2 and a molecular weight of 341.88 g/mol. Its IUPAC name is 3-[(2-aminopentanoylamino)methyl]-N-butan-2-ylbenzamide;hydrochloride.
| Compound Name | 3-[(2-aminopentanoylamino)methyl]-N-butan-2-ylbenzamide;hydrochloride |
|---|---|
| PubChem CID | 119287338 |
| Molecular Formula | C17H28ClN3O2 |
| Molecular Weight | 341.88 g/mol |
| Exact Mass | 341.19 |
| IUPAC Name | 3-[(2-aminopentanoylamino)methyl]-N-butan-2-ylbenzamide;hydrochloride |
| SMILES | CCCC(N)C(=O)NCc1cccc(C(=O)NC(C)CC)c1.Cl |
| InChI | InChI=1S/C17H27N3O2.ClH/c1-4-7-15(18)17(22)19-11-13-8-6-9-14(10-13)16(21)20-12(3)5-2;/h6,8-10,12,15H,4-5,7,11,18H2,1-3H3,(H,19,22)(H,20,21);1H |
| InChIKey | NSVHCKHIESXSRV-UHFFFAOYSA-N |
| XLogP | 2.38 |
| TPSA | 84.22 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 23 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 341.88 |
| LogP ≤ 5 | 2.38 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 3 |