C18H30ClN3O2 — CID 119719774
3-[[[(2S)-2-amino-4-methylpentanoyl]amino]methyl]-N-butan-2-ylbenzamide;hydrochloride (PubChem CID 119719774) has the molecular formula C18H30ClN3O2 and a molecular weight of 355.91 g/mol. Its IUPAC name is 3-[[[(2S)-2-amino-4-methylpentanoyl]amino]methyl]-N-butan-2-ylbenzamide;hydrochloride.
| Compound Name | 3-[[[(2S)-2-amino-4-methylpentanoyl]amino]methyl]-N-butan-2-ylbenzamide;hydrochloride |
|---|---|
| PubChem CID | 119719774 |
| Molecular Formula | C18H30ClN3O2 |
| Molecular Weight | 355.91 g/mol |
| Exact Mass | 355.20 |
| IUPAC Name | 3-[[[(2S)-2-amino-4-methylpentanoyl]amino]methyl]-N-butan-2-ylbenzamide;hydrochloride |
| SMILES | CCC(C)NC(=O)c1cccc(CNC(=O)[C@@H](N)CC(C)C)c1.Cl |
| InChI | InChI=1S/C18H29N3O2.ClH/c1-5-13(4)21-17(22)15-8-6-7-14(10-15)11-20-18(23)16(19)9-12(2)3;/h6-8,10,12-13,16H,5,9,11,19H2,1-4H3,(H,20,23)(H,21,22);1H/t13?,16-;/m0./s1 |
| InChIKey | PVHFGEAELURBJE-GPPWNDLUSA-N |
| XLogP | 2.63 |
| TPSA | 84.22 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 355.91 |
| LogP ≤ 5 | 2.63 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 3 |