C17H19FN4O2 — CID 166272217
N-[[3-(butan-2-ylcarbamoyl)phenyl]methyl]-5-fluoropyrimidine-2-carboxamide (PubChem CID 166272217) has the molecular formula C17H19FN4O2 and a molecular weight of 330.36 g/mol. Its IUPAC name is N-[[3-(butan-2-ylcarbamoyl)phenyl]methyl]-5-fluoropyrimidine-2-carboxamide.
| Compound Name | N-[[3-(butan-2-ylcarbamoyl)phenyl]methyl]-5-fluoropyrimidine-2-carboxamide |
|---|---|
| PubChem CID | 166272217 |
| Molecular Formula | C17H19FN4O2 |
| Molecular Weight | 330.36 g/mol |
| Exact Mass | 330.15 |
| IUPAC Name | N-[[3-(butan-2-ylcarbamoyl)phenyl]methyl]-5-fluoropyrimidine-2-carboxamide |
| SMILES | CCC(C)NC(=O)c1cccc(CNC(=O)c2ncc(F)cn2)c1 |
| InChI | InChI=1S/C17H19FN4O2/c1-3-11(2)22-16(23)13-6-4-5-12(7-13)8-21-17(24)15-19-9-14(18)10-20-15/h4-7,9-11H,3,8H2,1-2H3,(H,21,24)(H,22,23) |
| InChIKey | YDNILIYTEQPJQO-UHFFFAOYSA-N |
| XLogP | 2.07 |
| TPSA | 83.98 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 330.36 |
| LogP ≤ 5 | 2.07 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |