C22H30FIN4O — CID 111846876
N-butan-2-yl-3-[[[N-[(3-fluoro-4-methylphenyl)methyl]-N'-methylcarbamimidoyl]amino]methyl]benzamide;hydroiodide (PubChem CID 111846876) has the molecular formula C22H30FIN4O and a molecular weight of 512.41 g/mol. Its IUPAC name is N-butan-2-yl-3-[[[N-[(3-fluoro-4-methylphenyl)methyl]-N'-methylcarbamimidoyl]amino]methyl]benzamide;hydroiodide.
| Compound Name | N-butan-2-yl-3-[[[N-[(3-fluoro-4-methylphenyl)methyl]-N'-methylcarbamimidoyl]amino]methyl]benzamide;hydroiodide |
|---|---|
| PubChem CID | 111846876 |
| Molecular Formula | C22H30FIN4O |
| Molecular Weight | 512.41 g/mol |
| Exact Mass | 512.14 |
| IUPAC Name | N-butan-2-yl-3-[[[N-[(3-fluoro-4-methylphenyl)methyl]-N'-methylcarbamimidoyl]amino]methyl]benzamide;hydroiodide |
| SMILES | CCC(C)NC(=O)c1cccc(CN/C(=N/C)NCc2ccc(C)c(F)c2)c1.I |
| InChI | InChI=1S/C22H29FN4O.HI/c1-5-16(3)27-21(28)19-8-6-7-17(11-19)13-25-22(24-4)26-14-18-10-9-15(2)20(23)12-18;/h6-12,16H,5,13-14H2,1-4H3,(H,27,28)(H2,24,25,26);1H |
| InChIKey | OUGZZQULDAMMJG-UHFFFAOYSA-N |
| XLogP | 4.15 |
| TPSA | 65.52 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 29 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 512.41 |
| LogP ≤ 5 | 4.15 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'}, {'alert_name': 'iodine', 'substructure': 'N/A'} |
|---|