C24H34N4O4 — CID 111376120
N-butan-2-yl-3-[[[N'-methyl-N-[(3,4,5-trimethoxyphenyl)methyl]carbamimidoyl]amino]methyl]benzamide (PubChem CID 111376120) has the molecular formula C24H34N4O4 and a molecular weight of 442.56 g/mol. Its IUPAC name is N-butan-2-yl-3-[[[N'-methyl-N-[(3,4,5-trimethoxyphenyl)methyl]carbamimidoyl]amino]methyl]benzamide.
| Compound Name | N-butan-2-yl-3-[[[N'-methyl-N-[(3,4,5-trimethoxyphenyl)methyl]carbamimidoyl]amino]methyl]benzamide |
|---|---|
| PubChem CID | 111376120 |
| Molecular Formula | C24H34N4O4 |
| Molecular Weight | 442.56 g/mol |
| Exact Mass | 442.26 |
| IUPAC Name | N-butan-2-yl-3-[[[N'-methyl-N-[(3,4,5-trimethoxyphenyl)methyl]carbamimidoyl]amino]methyl]benzamide |
| SMILES | CCC(C)NC(=O)c1cccc(CN/C(=N\C)NCc2cc(OC)c(OC)c(OC)c2)c1 |
| InChI | InChI=1S/C24H34N4O4/c1-7-16(2)28-23(29)19-10-8-9-17(11-19)14-26-24(25-3)27-15-18-12-20(30-4)22(32-6)21(13-18)31-5/h8-13,16H,7,14-15H2,1-6H3,(H,28,29)(H2,25,26,27) |
| InChIKey | TZUCEGWPJVIRDN-UHFFFAOYSA-N |
| XLogP | 3.11 |
| TPSA | 93.21 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 32 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 442.56 |
| LogP ≤ 5 | 3.11 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'} |
|---|