C17H26N4O — CID 110980433
N-butan-2-yl-3-[[(N'-methyl-N-prop-2-enylcarbamimidoyl)amino]methyl]benzamide (PubChem CID 110980433) has the molecular formula C17H26N4O and a molecular weight of 302.42 g/mol. Its IUPAC name is N-butan-2-yl-3-[[(N'-methyl-N-prop-2-enylcarbamimidoyl)amino]methyl]benzamide.
| Compound Name | N-butan-2-yl-3-[[(N'-methyl-N-prop-2-enylcarbamimidoyl)amino]methyl]benzamide |
|---|---|
| PubChem CID | 110980433 |
| Molecular Formula | C17H26N4O |
| Molecular Weight | 302.42 g/mol |
| Exact Mass | 302.21 |
| IUPAC Name | N-butan-2-yl-3-[[(N'-methyl-N-prop-2-enylcarbamimidoyl)amino]methyl]benzamide |
| SMILES | C=CCN/C(=N\C)NCc1cccc(C(=O)NC(C)CC)c1 |
| InChI | InChI=1S/C17H26N4O/c1-5-10-19-17(18-4)20-12-14-8-7-9-15(11-14)16(22)21-13(3)6-2/h5,7-9,11,13H,1,6,10,12H2,2-4H3,(H,21,22)(H2,18,19,20) |
| InChIKey | LRCAZYAATCHHBB-UHFFFAOYSA-N |
| XLogP | 2.07 |
| TPSA | 65.52 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 22 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 302.42 |
| LogP ≤ 5 | 2.07 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|