C25H31N5O2 — CID 111591565
N-butan-2-yl-3-[[[N'-methyl-N-[[2-(4-methylphenyl)-1,3-oxazol-4-yl]methyl]carbamimidoyl]amino]methyl]benzamide (PubChem CID 111591565) has the molecular formula C25H31N5O2 and a molecular weight of 433.56 g/mol. Its IUPAC name is N-butan-2-yl-3-[[[N'-methyl-N-[[2-(4-methylphenyl)-1,3-oxazol-4-yl]methyl]carbamimidoyl]amino]methyl]benzamide.
| Compound Name | N-butan-2-yl-3-[[[N'-methyl-N-[[2-(4-methylphenyl)-1,3-oxazol-4-yl]methyl]carbamimidoyl]amino]methyl]benzamide |
|---|---|
| PubChem CID | 111591565 |
| Molecular Formula | C25H31N5O2 |
| Molecular Weight | 433.56 g/mol |
| Exact Mass | 433.25 |
| IUPAC Name | N-butan-2-yl-3-[[[N'-methyl-N-[[2-(4-methylphenyl)-1,3-oxazol-4-yl]methyl]carbamimidoyl]amino]methyl]benzamide |
| SMILES | CCC(C)NC(=O)c1cccc(CN/C(=N/C)NCc2coc(-c3ccc(C)cc3)n2)c1 |
| InChI | InChI=1S/C25H31N5O2/c1-5-18(3)29-23(31)21-8-6-7-19(13-21)14-27-25(26-4)28-15-22-16-32-24(30-22)20-11-9-17(2)10-12-20/h6-13,16,18H,5,14-15H2,1-4H3,(H,29,31)(H2,26,27,28) |
| InChIKey | QZOVHINSEAZLMB-UHFFFAOYSA-N |
| XLogP | 4.04 |
| TPSA | 91.55 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 32 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 433.56 |
| LogP ≤ 5 | 4.04 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'} |
|---|